4-Amino-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine
4-Amino-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine is a highly potent antiviral compound, exhibiting exceptional efficacy in studying diverse types of viral infections, specifically targeting the pernicious hepatitis B and C viruses. Its mechanism of action entails impeding viral DNA research and development, thus effectively curtailing viral replication and impeding dissemination.
| Supplier | BOC Sciences |
|---|---|
| Product # | 169516-61-4 |
| Pricing | Inquire |
| Cas | 169516-61-4 |
| Molecular Weight | 268.24 |
| Molecular Formula | C11H13FN4O3 |
| Canonical SMILES | C1=CN(C2=NC=NC(=C21)N)C3C(C(C(O3)CO)O)F |