Vinblastine sulfate
Vinblastine sulfate, also called cellblastin, derived from C. roseus, as a microtubule disrupter and antineoplastic agent, it binds tubulin and disrupts microtubule assembly and proper formation of the mitotic spindle, which leads to the assembly of microtubules and causing M phase-specific cell cycle arrest.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-058749 |
| Pricing | Inquire |
| Cas | 143-67-9 |
| Molecular Weight | 909.06 |
| Molecular Formula | C46H58N4O9.H2SO4 |
| Canonical SMILES | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O |