5-(3-(Heptan-2-yloxy)-5-(hexyloxy)benzyloxy)isophthalic acid
5-(3-(Heptan-2-yloxy)-5-(hexyloxy)benzyloxy)isophthalic acid, a synthetic compound widely used in the biomedical industry, exhibits diverse functionalities that present promising therapeutic applications for various diseases including cancer and inflammatory conditions. Nevertheless, the therapeutic effects and clinical safety of this compound necessitate more comprehensive investigations to be fully elucidated and evaluated.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0001-284819 |
| Pricing | Inquire |
| Molecular Weight | 486.60 |
| Molecular Formula | C28H38O7 |
| Canonical SMILES | CCCCCCOC1=CC(=CC(=C1)COC2=CC(=CC(=C2)C(=O)O)C(=O)O)OC(C)CCCCC |