Pazopanib HCl
Pazopanib is a novel multi-target inhibitor of VEGFR1, VEGFR2, VEGFR3, PDGFR, FGFR, c-Kit and c-Fms with IC50 of 10 nM, 30 nM, 47 nM, 84 nM, 74 nM, 140 nM and 146 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-146188 |
| Pricing | Inquire |
| Cas | 635702-64-6 |
| Molecular Weight | 473.98 |
| Molecular Formula | C21H23N7O2·HCl |
| Canonical SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N.Cl |