DC0-NH2
DC0-NH2 is an effector moiety for ADC and a simplified analog of DC1 with better stability. DC0-NH2 is about 1000-fold more cytotoxic than commonly used anticancer drugs (ex. Doxorubicin). DC0-NH2 can bind to the minor groove of DNA, followed by alkylation of adenine residues by its propabenzindole (CBI) component.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00681 |
| Pricing | Inquire |
| Cas | 615538-51-7 |
| Molecular Weight | 550.01 |
| Molecular Formula | C31H24ClN5O3 |
| Canonical SMILES | O=C(C(N1)=CC2=C1C=CC(N)=C2)NC3=CC4=C(NC(C(N5C[C@@H](CCl)C6=C5C=C(O)C7=CC=CC=C67)=O)=C4)C=C3 |