Actinomycin D
Actinomycin D is a chromopeptide antineoplastic antibiotic that exhibits high antibacterial and antitumor activity. Actinomycin D binds to single- and double-stranded DNA and subsequent inhibition of RNA and protein synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03755 |
| Pricing | Inquire |
| Cas | 50-76-0 |
| Molecular Weight | 1255.41 |
| Molecular Formula | C62H86N12O16 |
| Canonical SMILES | CC1C(C(=O)NC(C(=O)N2CCCC2C(=O)N(CC(=O)N(C(C(=O)O1)C(C)C)C)C)C(C)C)NC(=O)C3=C4C(=C(C=C3)C)OC5=C(C(=O)C(=C(C5=N4)C(=O)NC6C(OC(=O)C(N(C(=O)CN(C(=O)C7CCCN7C(=O)C(NC6=O)C(C)C)C)C)C(C)C)C)N)C |