2'-Amino-2'-deoxy-5'-O-(4,4'-dimethoxytrityl)uridine
2'-Amino-2'-deoxy-5'-O-(4,4'-dimethoxytrityl)uridine exhibits immense significance in the intricate process of nucleic acid synthesis. The assimilation of this entity augments the stability of pharmaceutical preparations and exerts a momentous impact on their metabolism, thereby endowing it with immense worth in the research of therapeutic interventions targeting multifarious maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 174221-86-4 |
| Pricing | Inquire |
| Cas | 174221-86-4 |
| Molecular Weight | 545.58 |
| Molecular Formula | C30H31N3O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=CC(=O)NC5=O)N)O |