S-cEt-C phosphoramidite
5'-ODMT cEt N-Bz 5-Me C Phosphoramidite is a specialized nucleotide compound utilized in oligonucleotide synthesis. This compound enables controlled modification of oligonucleotide sequences, facilitating the synthesis of customized oligonucleotides for various research and molecular biology applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00733 |
| Pricing | Inquire |
| Cas | 1197033-17-2 |
| Molecular Weight | 889.99 |
| Molecular Formula | C49H56N5O9P |
| Canonical SMILES | CC1C2(C(C(O1)C(O2)N3C=C(C(=NC3=O)NC(=O)C4=CC=CC=C4)C)OP(N(C(C)C)C(C)C)OCCC#N)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |