3'-Deoxy-3'-fluoroinosine
3'-Deoxy-3'-fluoroinosine, a critical and indispensable compound within the biomedical sector, stands out for its astonishing efficacy in combating a variety of viral infections such as HIV, hepatitis B, and hepatitis C. Functioning as a potent antiviral agent, this remarkable drug effectively hampers viral replication by selectively targeting key enzymes and impeding nucleoside metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 117517-20-1 |
| Pricing | Inquire |
| Cas | 117517-20-1 |
| Molecular Weight | 270.22 |
| Molecular Formula | C10H11FN4O4 |
| Canonical SMILES | C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)CO)F)O |