n-Octyl b-D-maltoside
Behold, n-Octyl b-D-maltoside, the nonionic detergent of biochemist's dreams! Revered for its fortitude in the purification of membrane proteins, this wondrous chemical also boasts the added talent of solubilizing and preserving the structure of these elusive proteins. Used far and wide in research, from investigations into cancer cells to the unraveling of glycoprotein diseases, n-Octyl b-D-maltoside is a true marvel of our scientific age.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82494-08-4 |
| Pricing | Inquire |
| Cas | 82494-08-4 |
| Molecular Weight | 454.51 |
| Molecular Formula | C20H38O11 |
| Canonical SMILES | CCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |