N-[(2R)-2-Hydroxy-2-(3-hydroxyphenyl)ethyl]-N-methylcarbamic Acid 1,1-Dimethylethyl Ester
N-[(2R)-2-Hydroxy-2-(3-hydroxyphenyl)ethyl]-N-methylcarbamic Acid 1,1-Dimethylethyl Ester is an degradation product of phenylephrine (P320630), an selective α1-adrenergic receptor agonist used mainly as a decongestant, as an agent to dilate the pupil, and to increase blood pressure.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060913 |
| Pricing | Inquire |
| Cas | 1049702-99-9 |
| Molecular Weight | 267.32 |
| Molecular Formula | C14H21NO4 |
| Canonical SMILES | CC(C)(C)OC(=O)N(C)CC(C1=CC(=CC=C1)O)O |