Tubulysin H
Tubulysin H is a highly cytotoxic peptide isolated from the myxobacterial species Archangium geophyra and Angiococcus disciformis. Tubulysin displays extremely potent cytotoxic activity in mammalian cells, including multidrug-resistant cell lines, with IC50 values in the lower nanomolar range. Tubulysin H inhibits tubulin polymerization and leads to cell cycle arrest and apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 799822-09-6 |
| Pricing | Inquire |
| Cas | 799822-09-6 |
| Molecular Weight | 785.99 |
| Molecular Formula | C40H59N5O9S |
| Canonical SMILES | CCC(C)C(C(=O)N(COC(=O)C)C(CC(C1=NC(=CS1)C(=O)NC(CC2=CC=CC=C2)CC(C)C(=O)O)OC(=O)C)C(C)C)NC(=O)C3CCCCN3C |