3-O-Methyl-L-DOPA Methyl Ester-[d3]
3-O-Methyl-L-DOPA Methyl Ester-[d3] is the labelled analogue of 3-O-Methyl-L-DOPA Methyl Ester, which is used to protect 3-O-Methyl-L-DOPA. 3-O-Methyl-L-DOPA is a L-tyrosine derivative that is the 3-methoxy derivative of L-dopa.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002786 |
| Pricing | Inquire |
| Cas | 1795785-77-1 |
| Molecular Weight | 228.26 |
| Molecular Formula | C11H12D3NO4 |
| Canonical SMILES | COC1=C(C=CC(=C1)CC(C(=O)OC)N)O |