Sulfamethoxazole-[d4]
Sulfamethoxazole-[d4] is the labelled analogue of Sulfamethoxazole. Sulfamethoxazole is an antibiotic and a structural analog of para-aminobenzoic acid (PABA). It competes with PABA to bind to dihydropteroate synthetase to inhibit the synthesis of dihydrofolic acid.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012599 |
| Pricing | Inquire |
| Cas | 1020719-86-1 |
| Molecular Weight | 257.30 |
| Molecular Formula | C10H7D4N3O3S |
| Canonical SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N |