6-Chloro-7-deaza-9-(a-D-ribofuranosyl)purine
6-Chloro-7-deaza-9-(a-D-ribofuranosyl)purine, an influential antiviral compound, stands as a stronghold in the biomedical industry, combating diverse viral infections, especially those instigated by RNA viruses. Showcasing its supremacy, this nucleoside analog unveils formidable antiviral prowess against RNA viruses such as influenza, hepatitis C, and dengue. Its ability to impede viral replication not only restrains the onslaught of viral ailments but also augments overall patient prognosis in unprecedented measures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 120401-32-3 |
| Pricing | Inquire |
| Cas | 120401-32-3 |
| Molecular Weight | 285.68 |
| Molecular Formula | C11H12ClN3O4 |
| Canonical SMILES | C1=CN(C2=C1C(=NC=N2)Cl)C3C(C(C(O3)CO)O)O |