3'-Deoxy-N2-DMF-5'-O-DMT-guanosine 2'-CE phosphoramidite
3'-Deoxy-N2-DMF-5'-O-DMT-guanosine 2'-CE phosphoramidite is an extensively utilized phosphoramidite derivative acting as an intricately modified nucleoside. Its prominent utility lies within the research and development of oligonucleotides intended for diverse biomedical scenarios, encompassing the development of nucleic acid-based therapeutics and diagnostic modalities.
Supplier | BOC Sciences |
---|---|
Product # | 196391-62-5 |
Pricing | Inquire |
Cas | 196391-62-5 |
Molecular Weight | 824.92 |
Molecular Formula | C43H53N8O7P |
Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1N2C=NC3=C2N=C(NC3=O)N=CN(C)C)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |