5-O-Benzyl-D-ribose
5-O-Benzyl-D-ribose, a compound of immense worth in the realm of biomedical sciences, finds wide-ranging applications for forging antiviral medications and combating diverse diseases. Its structural distinctiveness renders it pivotal in the synthesis of nucleoside analogs, renowned for their efficacy in impeding viral replication and the amelioration of viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72369-89-2 |
| Pricing | Inquire |
| Cas | 72369-89-2 |
| Molecular Weight | 240.25 |
| Molecular Formula | C12H16O5 |
| Canonical SMILES | C1=CC=C(C=C1)COCC(C(C(C=O)O)O)O |