Digallic acid
Digallic acid is a natural polyphenolic that can be produced by hydrolysis of gallotannins. Digallic acid has antioxidant activity that can be cytoprotective. Digallic acid inhibits reverse transcriptases from human immunodeficiency virus and murine leukemia virus. It also inhibits calcium-activated chloride channels, blocking the initial agonist-stimulated chloride current.
| Supplier | BOC Sciences |
|---|---|
| Product # | 536-08-3 |
| Pricing | Inquire |
| Cas | 536-08-3 |
| Molecular Weight | 322.2 |
| Molecular Formula | C14H10O9 |
| Canonical SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)O |