2'-Bromo-2'-deoxy-3'-O-methanesulfonyluridine
2'-Bromo-2'-deoxy-3'-O-methanesulfonyluridine is a remarkable antiviral compound employed in the research of diverse viral afflictions, encompassing herpes simplex and Epstein-Barr virus infections. It exhibits its efficacy by thwarting viral replication via its assimilation into viral DNA and consequential cessation of DNA chain elongation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18736-53-3 |
| Pricing | Inquire |
| Cas | 18736-53-3 |
| Molecular Weight | 547.04 |
| Molecular Formula | C9H14BrN2O14P3 |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=O)NC2=O)Br)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |