(d(CH2)51,Tyr(Me)2,Arg8)-Vasopressin
| Supplier | Creative Peptides |
|---|---|
| Product # | R1081 |
| CAS # | 73168-24-8 |
| Pricing | Inquire |
| LabelingTarget | Vasopressin Receptor |
| Synonyms | Manning Compound, [Pmp1, Tyr(OMe)2, Arg8] Vasopressin; β-Mercapto-β,β-cyclopentamethylene-propionyl-Tyr(Me)-Phe-Gln-Asn-Cys-Pro-Arg-Gly-NH2 trifluoroacetate salt (Disulfide bond) |
| MolecularFormula | C52H74N14O12S2 |
| MolecularWeight | 1151.38 |
| Source | Synthetic |
| Sequence | YFQNCPRG(Modifications: Tyr-1 = Pmp-Tyr(Me), Gly-8 = C-terminal amide) |
| Storage | -20°C |
| Explanation | Selective antagonist of vasopressin V1A receptor that inhibits vasopressin and oxytocin-induced increases in intracellular calcium concentrations in vitro (IC50 values are 5 and 30 nM respectively). Exhibits potent and prolonged antivasopressor activity and induces anxiolytic-like effects in the dorsal, but not ventral, hippocampus in vivo. |
| Activity | Antagonist |
| InChI | InChI=1S/C52H74N14O12S2/c1-78-32-16-14-31(15-17-32)25-35-46(73)63-36(24-30-10-4-2-5-11-30)47(74)61-34(18-19-40(53)67)45(72)64-37(26-41(54)68)48(75)65-38(29-79-80-52(27-43(70)60-35)20-6-3-7-21-52)50(77)66-23-9-13-39(66)49(76)62-33(12-8-22-58-51(56)57)44(71)59-28-42(55)69/h2,4-5,10-11,14-17,33-39H,3,6-9,12-13,18-29H2,1H3,(H2,53,67)(H2,54,68)(H2,55,69)(H,59,71)(H,60,70)(H,61,74)(H,62,76)(H,63,73)(H,64,72)(H,65,75)(H4,56,57,58)/t33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| InChIKey | QVQOGNOOAMQKCE-ZTYVOHGWSA-N |
| IsomericSMILES | COC1=CC=C(C=C1)C[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC3(CCCCC3)CC(=O)N2)C(=O)N4CCC[C@H]4C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N)CC5=CC=CC=C5 |
| Appearance | White lyophilised solid |
| Purity | >98% |