PKI (5-24)
PKI (5-24) is a competitive, non-reversible peptide inhibitor of PKA (cAMP-dependent protein kinase) (Ki = 2.3 nM). Its sequence is derived from the heat-stable skeletal muscle inhibitor protein of PKA. The PKA Inhibitor peptide binds to the catalytic subunit of PKA and displaces the regulatory subunit, and mimics protein substrate by binding to the catalytic site via the Arg-cluster basic residues.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010721 |
| Pricing | Inquire |
| Cas | 99534-03-9 |
| Molecular Weight | 2222.4 |
| Molecular Formula | C94H148N32O31 |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC1=CNC=N1)C(=O)NC(CC(=O)O)C(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)C(C(C)O)NC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)C(CO)NC(=O)C(C)NC(=O)C(C(C)CC)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C(C(C)O)NC(=O)C(C(C)O)N |