Sodium Indanylcarbinicillin
Sodium Indanylcarbinicillin, a penicillin-derived, has been used as a β-lactam antibiotic which inhibits the synthesis of peptidoglycan, a key component of the bacterial cell wall. It also has been shown to reduce blood pressure in mammals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26605-69-6 |
| Pricing | Inquire |
| Cas | 26605-69-6 |
| Molecular Weight | 516.54 |
| Molecular Formula | C26H25N2NaO6S |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)C(=O)OC4=CC5=C(CCC5)C=C4)C(=O)[O-])C.[Na+] |