Maslinic acid
Maslinic acid is a pentacyclic triterpene found in a variety of natural sources. It exerts a wide range of biological activities, such as antitumor, antidiabetic, antioxidant, cardioprotective, neuroprotective, antiparasitic and growth-stimulating.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6319 |
| Pricing | Inquire |
| Cas | 4373-41-5 |
| Molecular Weight | 472.7 |
| Molecular Formula | C30H48O4 |
| Canonical SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1)C)C(=O)O)C |