1,2,3,4,5-Penta-O-acetyl-b-D-fructose
1,2,3,4,5-Penta-O-acetyl-b-D-fructose, a highly esteemed compound within the biomedicine industry, exhibits remarkable capabilities in combatting an array of ailments including diabetes and obesity. Its distinguished attribute as an impediment to carbohydrate metabolism enzymes imparts it with vast potential for therapeutic advancements. Moreover, this prized entity serves as a pivotal building block for synthesizing pivotal pharmaceutical compounds, perpetuating its significance as a chemical intermediate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20764-61-8 |
| Pricing | Inquire |
| Cas | 20764-61-8 |
| Molecular Weight | 390.34 |
| Molecular Formula | C16H22O11 |
| Canonical SMILES | CC(=O)OCC1(C(C(C(CO1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |