5-Hydroxycytidine
5-Hydroxycytidine is a nucleoside derivative primarily used in compound for studying the role of modified nucleosides in cancer therapy and antiviral drug development. With its potential antitumor and antiviral activities, 5-Hydroxycytidine serves as an important tool in the exploration of drug targets and research strategies for various types of cancers and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39638-73-8 |
| Pricing | Inquire |
| Cas | 39638-73-8 |
| Molecular Weight | 259.22 |
| Molecular Formula | C9H13N3O6 |
| Canonical SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)O)O)N)O |