iota-Cyclodextrin
iota-Cyclodextrin is a versatile substance extensively utilized in the biomedical sector, exhibiting remarkable potential as a pharmaceutical transporter. By amplifying the solubility and stability of diverse compounds, it functions as an efficacious drug delivery compound. Empowered by its ability to form inclusion complexes, it proficiently enwraps hydrophobic compounds, thereby facilitating the research of ailments such as cancer, diabetes and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 156510-94-0 |
| Pricing | Inquire |
| Cas | 156510-94-0 |
| Molecular Weight | 2269.97 |
| Molecular Formula | C84H140O70 |
| Canonical SMILES | C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(C(C9O)O)OC1C(OC(C(C1O)O)OC1C(OC(C(C1O)O)OC1C(OC(C(C1O)O)OC1C(OC(C(C1O)O)OC1C(OC(C(C1O)O)OC1C(OC(O2)C(C1O)O)CO)CO)CO)CO)CO)CO)CO)CO)CO)CO)CO)CO)CO)O)O)O |