G-TPP
G-TPP is a mitochondria-targeted Hsp90 inhibitor that increases cell death in HeLa and MCF7 cells, consistently inhibits cell death induced by oxidative stress and mitochondrial dysfunction induced by PINK1 mutation in mouse embryonic fibroblast cells and DA cell models such as SH-SY5Y and SN4741 cells. Additionally, G-TPP also suppresses the defective locomotive activity and DA neuron loss in Drosophila PINK1 null mutants.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1131626-46-4 |
| Pricing | Inquire |
| Cas | 1131626-46-4 |
| Molecular Weight | 890.85 |
| Molecular Formula | C52H65N3O8P |
| Canonical SMILES | CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCCCCC[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C)OC)OC(=O)N)C)C)O)OC |