Thalidomide-O-amido-PEG2-C2-NH2 hydrochloride
Thalidomide-O-amido-PEG2-C2-NH2 hydrochloride is a synthetic E3 ligand-linker conjugate containing a cereblon ligand based on Thalidomide and a PEG linker of 2 O(CH2)2 units with ethylamine terminal, as a part of a variety of functionalized PROTAC molecules for binding to a target protein ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2376990-30-4 |
| Pricing | Inquire |
| Cas | 2376990-30-4 |
| Molecular Weight | 498.91 |
| Molecular Formula | C₂₁H₂₇ClN₄O₈ |
| Canonical SMILES | NCCOCCOCCNC(COC1=C2C(N(C(C2=CC=C1)=O)C3CCC(NC3=O)=O)=O)=O.Cl |