5'-Adenylic acid monoanhydride with (difluorophosphonomethyl) phosphonic acid
5'-Adenylic acid monoanhydride with (difluorophosphonomethyl) phosphonic acid, a compound extensively used in the biomedical sector, has been widely acknowledged as an antiviral drug par excellence for the management of herpes virus infections. Its modus operandi involves curtailing viral DNA synthesis, which, in turn, impedes the proliferation and transmission of viruses. Its efficacy is unequivocal, rendering it a go-to recommendation for medical practitioners. In certain cases, it is judiciously combined with other antiviral therapies to augment its efficiency.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81336-78-9 |
| Pricing | Inquire |
| Cas | 81336-78-9 |
| Molecular Weight | 509.19 |
| Molecular Formula | C11H16F2N5O10P3 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(CP(=O)(F)F)O)O)O)N |