2-Amino-3'-deoxy-3'-fluoroadenosine
2-Amino-3'-deoxy-3'-fluoroadenosine is a potent nucleoside analog, boasting a distinctive structure and mechanism of action. Extensive research has highlighted the considerable potential of this compound for combating a spectrum of ailments, notably viral infections such as hepatitis B and C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125391-75-5 |
| Pricing | Inquire |
| Cas | 125391-75-5 |
| Molecular Weight | 284.25 |
| Molecular Formula | C10H13FN6O3 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)F)O)N)N |