Isochlorogenic acid A
Isochlorogenic acid A is found in Lonicera japonica, it shows neuroprotective effects on SH-SY5Y cells and senescence-accelerated-prone mice 8 through the up-regulation of phosphoglycerate kinase-1. 3,5-di-O-caffeoylquinic acid also has antioxidant and anti-complementary activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89919-62-0 |
| Pricing | Inquire |
| Cas | 89919-62-0 |
| Molecular Weight | 516.45 |
| Molecular Formula | C25H24O12 |
| Canonical SMILES | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O |