Deoxycholic acid
Deoxycholic acid is one of the secondary bile acids, which are metabolic byproducts of intestinal bacteria. Deoxycholic acid is specifically responsible for activating the G-protein-coupled bile acid receptor TGR5, stimulating the thermogenic activity of brown adipose tissue (BAT).
Supplier | BOC Sciences |
---|---|
Product # | NP6088 |
Pricing | Inquire |
Cas | 83-44-3 |
Molecular Weight | 392.58 |
Molecular Formula | C24H40O4 |
Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |