Ramelteon Impurity 24
Ramelteon Impurity 24 is an impurity of Ramelteon. Ramelteon is a potent and selective agonist at melatonin MT1/MT2 receptor. Ramelteon is a sleep agent medication used to treat sleeplessness (insomnia).
| Supplier | BOC Sciences |
|---|---|
| Product # | 896736-22-4 |
| Pricing | Inquire |
| Cas | 896736-22-4 |
| Molecular Weight | 273.33 |
| Molecular Formula | C16H19NO3 |
| Canonical SMILES | CCC(=O)NCCC1CC(=O)C2=C1C3=C(C=C2)OCC3 |