2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucose
2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucose, an organic compound, is frequently implemented as a predecessor in the fabrication of glycopeptides and glycosides. Additionally, it has been scrutinized for its prospective effectiveness in hampering the growth of distinctive cancer cells and as a germicide.
| Supplier | BOC Sciences |
|---|---|
| Product # | 50605-09-9 |
| Pricing | Inquire |
| Cas | 50605-09-9 |
| Molecular Weight | 261.274 |
| Molecular Formula | C11H19NO6 |
| Canonical SMILES | CC(=O)NC1C(C2C(COC(O2)(C)C)OC1O)O |