Benzyl 2-acetamido-2,4-dideoxy-4-fluoro-a-D-glucopyranose
Benzyl 2-acetamido-2,4-dideoxy-4-fluoro-α-D-glucopyranose, a remarkable compound, finds promising utility within the biomedical sphere for combatting bacterial infections. Its exceptional efficacy in impeding bacterial growth and thwarting disease causation has been substantiated.
| Supplier | BOC Sciences |
|---|---|
| Product # | 290819-73-7 |
| Pricing | Inquire |
| Cas | 290819-73-7 |
| Molecular Weight | 313.32 |
| Molecular Formula | C15H20FNO5 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCC2=CC=CC=C2)CO)F)O |