2-Amino-1-methyl-6-phenylimidazo[4,5-b]pyridine
2-Amino-1-methyl-6-phenylimidazo[4,5-b]pyridine (PhIP) is a food-derived carcinogen that is found in high temperature-cooked fish and meat. In humans, PhIP is metabolized by the cytochrome (CYP) P450 isoform CYP1A2 and conjugated by N-acetyltransferase or sulfotransferase to a metabolite that reacts with DNA to form adducts, which are directly correlated with increased risk of breast, colon, and prostate cancers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105650-23-5 |
| Pricing | Inquire |
| Cas | 105650-23-5 |
| Molecular Weight | 224.3 |
| Molecular Formula | C13H12N4 |
| Canonical SMILES | CN1C2=C(N=CC(=C2)C3=CC=CC=C3)N=C1N |