Lividomycin B
It is produced by the strain of Str. lividus 2230-N. It's an aminoglycoside antibiotic. It has a broad-spectrum effect against bacteria and mycobacterium, and has no cross-resistance with Streptomyces and penicillium, and has protective effect on mice infected with S. aureus and Pseudomonas aeruginosa.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02269 |
| Pricing | Inquire |
| Cas | 37636-51-4 |
| Molecular Weight | 599.63 |
| Molecular Formula | C23H45N5O13 |
| Canonical SMILES | C1C(C(C(C(C1N)OC2C(CC(C(O2)CO)O)N)OC3C(C(C(O3)CO)OC4C(C(C(C(O4)CN)O)O)N)O)O)N |