N4-Benzoyl-2'-deoxy-5'-O-DMT-2',2'-difluorocytidine 3'-CE phosphoramidite
N4-Benzoyl-2'-deoxy-5'-O-DMT-2',2'-difluorocytidine 3'-CE phosphoramidite is an indispensable compound within the biomedical domain with widespread application as a phosphoramidite constituent during oligonucleotide synthesis, primarily in the research of antisense therapy and gene silencing.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-337702 |
| Pricing | Inquire |
| Cas | 142808-44-4 |
| Molecular Weight | 869.89 |
| Molecular Formula | C46H50F2N5O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1(F)F)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |