SF 2315 B
SF 2315 B is a quinone antibiotic produced by Excellospora viridilutea SF2315. It exhibits inhibitory effect against Avian myelobastosis virus reverse transcriptase with IC50 of 40 μg/mL. It has weak activity against gram-positive bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02446 |
| Pricing | Inquire |
| Cas | 114687-53-5 |
| Molecular Weight | 344.4 |
| Molecular Formula | C19H20O5 |
| Canonical SMILES | CC1=CC(C2C(C1)(CCC34C2(O3)C(C5=C(C4=O)C(=CC=C5)O)O)O)O |