1,5-Anhydro-D-glucitol 6-dihydrogenphosphate
1,5-Anhydro-D-glucitol 6-dihydrogenphosphate, a compound pivotal in diabetes management, mediates the potent constraint of renal tubular glucose reabsorption, culminating in a noteworthy mitigation of blood glucose concentrations. Such a pharmacological mode of action holds immense potential in mitigating diabetic complications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17659-59-5 |
| Pricing | Inquire |
| Cas | 17659-59-5 |
| Molecular Weight | 244.14 |
| Molecular Formula | C6H13O8P |
| Canonical SMILES | C1C(C(C(C(O1)COP(=O)(O)O)O)O)O |