Fumitremorgin B
Fumitremorgin B is a natural compound isolated from the fermentation broth of Aspergillus fumigatus LN-4. Fumitremorgin B is a tremorgenic mycotoxin that is active against the phytopathogenic fungi. It has antifeedant activity against armyworm (M. separata) larvae when applied to fresh wheat leaves.
Supplier | BOC Sciences |
---|---|
Product # | 12626-17-4 |
Pricing | Inquire |
Cas | 12626-17-4 |
Molecular Weight | 479.57 |
Molecular Formula | C27H33N3O5 |
Canonical SMILES | CC(=CCN1C2=C(C=CC(=C2)OC)C3=C1C(N4C(=O)C5CCCN5C(=O)C4(C3O)O)C=C(C)C)C |