2-Cyclohexylpropan-2-yl Methacrylate (stabilized with Phenothiazine)
2-Cyclohexylpropan-2-yl Methacrylate (stabilized with Phenothiazine) is a specially formulated chemical used in the biomedical space. It acts as a monomer for the production of functional polymers useful for drug delivery systems and helps in the controlled release of various drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 186585-56-8 |
| Pricing | Inquire |
| Cas | 186585-56-8 |
| Molecular Weight | 210.32 |
| Molecular Formula | C13H22O2 |
| Canonical SMILES | CC(=C)C(=O)OC(C)(C)C1CCCCC1 |