2,3-Dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
2,3-Dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an important pharmaceutical intermediate commonly employed in the synthesis of various drugs. It plays a critical role in the production of novel molecules for the treatment of different diseases, including cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1131335-62-0 |
| Pricing | Inquire |
| Cas | 1131335-62-0 |
| Molecular Weight | 265.1132 |
| Molecular Formula | C13H20BNO4 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=C(C=C2)OC)OC |