Solvent Yellow 43
Solvent Yellow 43 is a versatile product widely used in the biomedical industry. It plays a crucial role as a fluorescent dye in various applications. This product is particularly valuable in the field of drug discovery, where it aids in the identification and characterization of specific drugs and their targets. Its fluorescence properties make it an excellent tool for visualizing and studying cellular processes and diseases such as cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 19125-99-6 |
| Pricing | Inquire |
| Cas | 19125-99-6 |
| Molecular Weight | 324.42 |
| Molecular Formula | C20H24N2O2 |
| Canonical SMILES | CCCCNC1=C2C=CC=C3C2=C(C=C1)C(=O)N(C3=O)CCCC |