C-Peptide 1 (rat)
C-Peptide 1 (rat) specifically binds to G-protein-coupled membrane receptors in the nanomolar concentration range, and subsequently activates Ca2+-dependent intracellular signaling pathways. This leads to a stimulation of the activity of both Na+-K+-ATPase, and endothelial nitric oxide synthase. Administration of C-peptide to streptozotocin induced diabetic rats elicited a substantial increase in whole-body glucose turnover.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015331 |
| Pricing | Inquire |
| Cas | 41475-27-8 |
| Molecular Weight | 3259.53 |
| Molecular Formula | C140H228N38O51 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCC(=O)N)C(=O)O)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(C(C)O)NC(=O)C(CCC(=O)N)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(C)NC(=O)C(CCC(=O)O)NC(=O)C1CCCN1C(=O)CNC(=O)CNC(=O)CNC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C(CCC(=O)N)NC(=O)C3CCCN3C(=O)C(CC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(C(C)C)NC(=O)C(CCC(=O)O)N |