3-Bromo-5-fluoro-2-propoxyphenylboronic acid
3-Bromo-5-fluoro-2-propoxyphenylboronic acid is a vital compound used in the biomedicine industry. It exhibits potential in drug discovery and development, specifically in the treatment of various diseases. This product serves as a key component for synthesizing novel pharmaceuticals targeting specific diseases, contributing to the advancement of biomedical research and improving patient outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 868272-84-8 |
| Pricing | Inquire |
| Cas | 868272-84-8 |
| Molecular Weight | 276.90 |
| Molecular Formula | C9H11BBrFO3 |
| Canonical SMILES | B(C1=CC(=CC(=C1OCCC)Br)F)(O)O |