QX 314 chloride
QX 314 chloride, a membrane-impermeant lidocaine derivative, is a blocker of voltage-activated Na+ channels. QX-314 elicits a long-lasting decrease in the response to painful mechanical and thermal stimuli without imparting the motor deficits (e.g., numbness, paralysis) associated with many conventional local anesthetics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5369-03-9 |
| Pricing | Inquire |
| Cas | 5369-03-9 |
| Molecular Weight | 298.85 |
| Molecular Formula | C16H27N2OCl |
| Canonical SMILES | CC[N+](CC)(CC)CC(=O)NC1=C(C=CC=C1C)C.[Cl-] |