Chenodeoxycholic acid 24-acyl-b-D-glucuronide
Chenodeoxycholic acid 24-acyl-β-D-glucuronide is an indispensable constituent within the biomedical domain predominantly employed for the therapeutic research of hepatic ailments including cholestasand biliary cirrhosis. This compound exerts formidable hepatoprotective attributes and ensures the homeostasis of bile acid metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 208038-27-1 |
| Pricing | Inquire |
| Cas | 208038-27-1 |
| Molecular Weight | 568.70 |
| Molecular Formula | C30H48O10 |
| Canonical SMILES | CC(CCC(=O)OC1C(C(C(C(O1)C(=O)O)O)O)O)C2CCC3C2(CCC4C3C(CC5C4(CCC(C5)O)C)O)C |