Heptakis(2,3-di-O-acetyl-6-O-tert-butyldimethylsilyl)cyclomaltoheptaose
Heptakis(2,3-di-O-acetyl-6-O-tert-butyldimethylsilyl)cyclomaltoheptaose, a highly significant compound extensively utilized in the biomedical sector, assumes a pivotal role in diverse therapeutic applications. With its remarkable capacity to effectively combat numerous afflictions, this product stands out as an indispensable entity within the realm of modern biomedical research and development. Beneath its intricately designed structure lies a potent agent capable of precisely targeting specific medications or facilitating the development of innovative drug delivery systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | 123172-94-1 |
| Pricing | Inquire |
| Cas | 123172-94-1 |
| Molecular Weight | 2523.32 |
| Molecular Formula | C112H196O49Si7 |
| Canonical SMILES | CC(=O)OC1C2C(OC(C1OC(=O)C)OC3C(OC(C(C3OC(=O)C)OC(=O)C)OC4C(OC(C(C4OC(=O)C)OC(=O)C)OC5C(OC(C(C5OC(=O)C)OC(=O)C)OC6C(OC(C(C6OC(=O)C)OC(=O)C)OC7C(OC(C(C7OC(=O)C)OC(=O)C)OC8C(OC(O2)C(C8OC(=O)C)OC(=O)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |