2-(2,2,2-Trimethylacetamido)pyridine-3-boronic acid pinacol ester
2-(2,2,2-Trimethylacetamido)pyridine-3-boronic acid pinacol ester is utilized in the biomedical industry for the synthesis of various pharmaceutical compounds. Its boronic acid pinacol ester group plays a crucial role in Suzuki coupling reactions, aiding in drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 532391-30-3 |
| Pricing | Inquire |
| Cas | 532391-30-3 |
| Molecular Weight | 304.19 |
| Molecular Formula | C16H25BN2O3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)NC(=O)C(C)(C)C |